Hydralazine Hydrochloride
API Standard
| Catalog Number | CS-O-11664 |
| Alternative Name(s) | 1-Hydrazinylphthalazine Hydrochloride |
| Research Area | Hydralazine is a non-nucleoside analog that inhibits DNA methylation and reactivates the expression of tumor suppressor genes. Non-selective MAO-A/B inhibitor; semicarbazide-sensitive amine oxidase inhibitor. Antihypertensive. |
| Molecular Formula | C8H9ClN4 |
| CAS# | 304-20-1 |
| Purity | >98% |
| SMILES | N/N=C1C(C=CC=C2)=C2C=NN/1.Cl |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO11664.html |