PPO-IN-10 | MedChemExpress (MCE)
PPO-IN-10 (Compound 4) is a 2-phenylpyridine derivative of pyrrolidone. PPO-IN-10 inhibits protoporphyrinogen IX oxidase (PPO). PPO-IN-10 leads to the formation of photosensitive protoporphyrin IX and the death of weed leaves. PPO-IN-10 can be used in the research of developing new PPO herbicides[1].
| Trivial name | PPO-IN-10 |
| Catalog Number | HY-161503 |
| Research Area | Others |
| CAS# | 3034607-58-1 |
| Purity | ≥98.0% |
| SMILES | O=C(C1C(N(C2=CC(C3=NC=C(C(F)(F)F)C=C3Cl)=C(F)C=C2Cl)CC1)=O)NCCCC |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ppo-in-10.html |