SDMA
SMDA (symmetric dimethylarginine) is a methylated form of arginine found within all nucleated cells that is released into circulation after proteolysis, then excreted through the kidneys, and correlates well with GFR (glomerular filtration rate) in people, dogs, and cats.
| Trivial name | symmetric dimethylarginine |
| Catalog Number | S5838 |
| Molecular Formula | C28H25N3O6S2 |
| CAS# | 30344-00-4 |
| Inchi | #N/A |
| Inchi Key | #N/A |
| SMILES | COC1=CC=CC=C1C(N[S](=O)(=O)C2=CC3=C(NC(=O)C=C3)C=C2)C(=O)N(CC4=CC=CO4)CC5=CC=CS5 |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/sdma.html |
| Additional Information | https://file.selleck.cn/downloads/struct/sdma-chemical-structure-s5838.gif |
