6-Methoxyflavanone | MedChemExpress (MCE)
6-Methoxyflavanone (6-MeOF) is an orally active flavonoid compound. 6-Methoxyflavanone has anxiolytic properties. 6-Methoxyflavanone targets unique sites on GABA-A receptors, different from traditional benzodiazepines. 6-Methoxyflavanone can be used to study anxiety disorders. 6-Methoxyflavanone readily crosses the blood brain barrier (BBB)[1].
| Trivial name | 6-Methoxyflavanone |
| Catalog Number | HY-N8852 |
| Alternative Name(s) | 6-MeOF |
| Research Area | Neurological Disease |
| CAS# | 3034-04-6 |
| Purity | ≥98.0% |
| SMILES | O=C1CC(C2=CC=CC=C2)OC3=CC=C(OC)C=C13 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/6-methoxyflavanone.html |