PI3K/AKT-IN-1
PI3K/AKT-IN-1 is a dual-acting inhibitor of PI3K/AKT pathway with an IC50 of 6.99 µM, 4.01 µM, and 3.36 µM, for PI3Kδ, PI3Kγ and AKT-1 respectively. It also induces S-phase cell cycle arrest, caspase-3-dependent apoptosis, exhibiting strong potential against breast cancer and leukemia.
| Catalog Number | E4683 |
| Molecular Formula | C10H16N2O2S4 |
| CAS# | 3033069-84-7 |
| SMILES | C1COCCN1C(=S)SSC(=S)N2CCOCC2 |
| Size | 100mg |
| Supplier Page | http://www.selleckchem.com/products/pi3k-akt-in-1.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E4683-PI3K-AKT-IN-1-chemical-structure.png |