NLRP3-IN-37 | MedChemExpress (MCE)
NLRP3-IN-37 (Compound 23) is a NLRP3 inhibitor (EC50: 5 nM). NLRP3-IN-37 can be used for NLRP3 related research, such as gout, pseudogout, CAPS, NASH fibrosis, heart failure, idiophathic pericarditis, atopic dermatitis, inflammatory bowel disease, Alzheimer’s Disease, Parkinson’s Disease and traumatic brain injury[1].
| Trivial name | NLRP3-IN-37 |
| Catalog Number | HY-163498 |
| Research Area | Neurological Disease; Inflammation/Immunology |
| CAS# | 3033054-51-9 |
| Purity | ≥98.0% |
| SMILES | [H][C@@]12CCN(C)C[C@@]1(N(CC2)C3=C4N=CC=CC4=C(N=N3)C5=CC=C(C=C5O)C(F)(F)F)[H] |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/nlrp3-in-37.html |