EGFR T790M/L858R-IN-7 | MedChemExpress (MCE)
EGFR T790M/L858R-IN-7 (Compound 72) is a novel pyrimidine compound that inhibits the EGFR T790M and L858R mutation with a high efficacy (93% inhibition rate at 0.05 μM). EGFR T790M/L858R-IN-7 functions by specifically binding to the kinase domain of EGFR, thereby inhibiting its phosphorylation activity[1].
| Trivial name | EGFR T790M/L858R-IN-7 |
| Catalog Number | HY-158178 |
| Research Area | Cancer |
| CAS# | 3032760-90-7 |
| Purity | ≥98.0% |
| SMILES | O=C(NC1=CC(NC2=NC=CC(N3C=CC4=CC=CN=C43)=N2)=C(OC)C=C1OC)/C=C/CN5CCOCC5 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/egfr-t790m-l858r-in-7.html |