TAK-715
TAK-715 is a p38 MAPK inhibitor for p38α with IC50 of 7.1 nM, being 28-fold selective for p38α over p38β, showing no inhibition to p38γ/δ, JNK1, ERK1, IKKβ, MEKK1 or TAK1.
| Trivial name | / |
| Catalog Number | CSN15958 |
| Alternative Name(s) | / |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C24H21N3OS |
| CAS# | 303162-79-0 |
| Purity | ≥98% |
| SMILES | O=C(NC1=NC=CC(C2=C(C3=CC=CC(C)=C3)N=C(CC)S2)=C1)C4=CC=CC=C4 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/tak-715.html |