TAK-715 10mM * 1mL in DMSO
TAK 715 an inhibitor of p38 MAPK (IC50 = 7.1 nM for p38 MAPK??), Wnt/beta-catenin signaling, and Inhibits 22 kinases by more than 80%, including CK 1??/??.
| Trivial name | TAK-715 10mM * 1mL in DMSO |
| Catalog Number | A11582-10mM-D |
| Alternative Name(s) | N-(4-(2-Ethyl-4-(3-methylphenyl)-thiazol-5-yl)pyridin-2-yl)benzamide |
| Molecular Formula | C24H21N3OS |
| CAS# | 303162-79-0 |
| SMILES | CCC1=NC(=C(S1)C2=CC(=NC=C2)NC(=O)C3=CC=CC=C3)C4=CC(=CC=C4)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/tak-715.html |
