Antifungal agent 94 | MedChemExpress (MCE)
Antifungal agent 94 (Compound 49) is a Flavonoid derivative, which exhibits antifungal activity with EC50 of 0.28 μM and a half-maximal effective concentration of 0.46 μg/mL against Rhizoctonia solani[1].
| Trivial name | Antifungal agent 94 |
| Catalog Number | HY-158053 |
| Research Area | Infection |
| CAS# | 3030502-21-4 |
| Purity | ≥98.0% |
| SMILES | O=C1C(C(N(C(C)=O)N=C2S(=O)(CCCC)=O)S2=O)=COC3=C1C=C(Cl)C=C3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/antifungal-agent-94.html |