Claramine TFA | MedChemExpress (MCE)
Claramine TFA is a steroidal polyamine. Claramine TFA can regulate the properties of lipid membranes and protect cells from various biological toxins, including misfolded protein oligomers and toxins derived from biological proteins[1].
Trivial name | Claramine TFA |
Catalog Number | HY-160791A |
Research Area | Infection; Cancer |
CAS# | 3030428-57-7 |
Purity | ≥98.0% |
SMILES | C[C@@]12[C@]3([H])[C@](C[C@H](C1([H])C[C@H](CC2)O)NCCCNCCCCNCCCN)([H])[C@@]4([H])[C@](CC3)([C@@](CC4)([H])[C@H](C)CCCC(C)C)C.OC(C(F)(F)F)=O |
Size | 10 mg |
Supplier Page | https://www.medchemexpress.com/claramine-tfa.html |