Coenzyme Q10
Coenzyme Q10 is a component of the electron transport chain and participates in aerobic cellular respiration.
| Trivial name | Ubiquinone; Ubidecarenone, Coenzyme Q; Co Q10 |
| Catalog Number | CSN12629 |
| Alternative Name(s) | Ubiquinone; Ubidecarenone, Coenzyme Q; Co Q10 |
| Research Area | / |
| Molecular Formula | C59H90O4 |
| CAS# | 303-98-0 |
| Purity | ≥99% |
| SMILES | O=C(C(OC)=C1OC)C(C)=C(C/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CCC=C(C)C)C1=O |
| Size | 250mg |
| Supplier Page | https://www.csnpharm.com/products/coenzyme-q10.html |