Coenzyme Q10
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-08364 |
| Alternative Name(s) | Ubidecarenone;2-[(2E,6E,10E,14E,18E,22E,26E,30E,34E)-3,7,11,15,19,23,27,31,35,392,26,30,34,38dimethoxy-3-methycclohexa-2,5-diene-1,4-dione;Ubidcarenone. |
| Research Area | Antibacterial and antioxidant for preventing and treating cancer. |
| Molecular Formula | C59H90O4 |
| CAS# | 303-98-0 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C/C(CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/CC/C=C(C)/C)=CCC(C(C(OC)=C(OC)C1=O)=O)=C1C |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO08364.html |
| Additional Information | NULL |