Clomipramine
Clomipramine(Hydiphen, Anafranil base) blocks the production of norepinephrine in the central nervous system and 5-HT reuptake, thereby exerting sedative and anticholinergic effects, with IC50 of 1.5 nM. Clomipramine is also a non-selective monoamine reuptake inhibitor that can affect the transmission of multiple neurotransmitters.
| Trivial name | Hydiphen, Anafranil base |
| Catalog Number | E4907 |
| Molecular Formula | C20H16Br2O3 |
| CAS# | 303-49-1 |
| SMILES | OC1=C(Br)C=C(C=C1)\C=C2/CCC\C(=C/C3=CC(=C(O)C=C3)Br)C2=O |
| Size | 1g |
| Supplier Page | http://www.selleckchem.com/products/clomipramine.html |
| Additional Information | https://file.selleck.cn/downloads/struct/E4907-Clomipramine-chemical-structure.png |
