Gossypol 10mM * 1mL in DMSO
Gossypol is a polyphenolic aldehyde that permeates cells and acts as an inhibitor for several dehydrogenase enzymes.
| Trivial name | Gossypol 10mM * 1mL in DMSO |
| Catalog Number | A10435-10mM-D |
| Alternative Name(s) | 2,2'-Bis(8-Formyl-1,6,7-trihydroxy-5-isopropyl-3-methylnaphthalene) |
| Molecular Formula | C30H30O8 |
| CAS# | 303-45-7 |
| SMILES | CC1=C(C(=C2C(=C1)C(=C(C(=C2C=O)O)O)C(C)C)O)C3=C(C=C4C(=C3O)C(=C(C(=C4C(C)C)O)O)C=O)C |
| Size | 10mM * 1mL in DMSO |
| Supplier Page | http://www.adooq.com/gossypol.html |