Dasatinib (BMS-354825) 10mM * 1mL in DMSO
Dasatinib (BMS-354825) is an oral multi- BCR/ABL and Src family tyrosine kinase inhibitor. The main targets of dasatinib, are BCR/ABL, Src, c-Kit, ephrin receptors, and several other tyrosine kinases, but not erbB kinases such as EGFR or Her2.
Trivial name | Dasatinib (BMS-354825) 10mM * 1mL in DMSO |
Catalog Number | A10290-10mM-D |
Alternative Name(s) | N-(2-chloro-6-methylphenyl)-2-[[6-[4-(2-hydroxyethyl)-1-piperazinyl]-2-methyl-4-pyrimidinyl]amino]-5-thiazole carboxamide monohydrate |
Molecular Formula | C22H26ClN7O2S |
CAS# | 302962-49-8 |
SMILES | CC1=C(C(=CC=C1)Cl)NC(=O)C2=CN=C(S2)NC3=NC(=NC(=C3)N4CCN(CC4)CCO)C |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/dasatinib-bms-354825.html |