VVD-214 | MedChemExpress (MCE)
VVD-214 is a synthetic lethal allosteric inhibitor of WRN helicase. VVD-214 covalently binds to cysteine 727 of WRN and inhibits ATP hydrolysis and helicase activity. VVD-214 is potent in causing double-stranded DNA breaks, nuclear swelling, and cell death in high microsatellite instability (MSI) cancers[1].
| Trivial name | VVD-214 |
| Catalog Number | HY-158116 |
| Alternative Name(s) | RO7589831; VVD-133214 |
| Research Area | Cancer |
| CAS# | 3026500-20-6 |
| Purity | ≥98.0% |
| SMILES | CS(/C=C/[C@H](C1CC1)NC(C(C(OC2=CC=CC=C2)=N3)=CN=C3C(F)(F)C)=O)(=O)=O |
| Size | 50 mg |
| Supplier Page | https://www.medchemexpress.com/vvd-214.html |