PAR4 antagonist 5 | MedChemExpress (MCE)
PAR4 antagonist 5 (compound 1) is a PAR4 antagonist with an IC50 less than 20 μM and potent anti-platelet aggregation activity. PAR4 antagonist 5 can be used for research of thrombosis disease [1].
| Trivial name | PAR4 antagonist 5 |
| Catalog Number | HY-163504 |
| Research Area | Cardiovascular Disease |
| CAS# | 3024653-17-3 |
| Purity | ≥98.0% |
| SMILES | COC1=CC2=C(N=C(C3=C4N=NC(OC)=CC4=CC(C)=C3)S2)C(Cl)=C1 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/par4-antagonist-5.html |
