ELQ-598 | MedChemExpress (MCE)
ELQ-598, as a prodrug, is converted into the active drug ELQ-596 upon oral administration. ELQ-598 demonstrates potent parasitic growth inhibition capabilities (IC50= 37 nM). ELQ-598 also shows low toxicity towards human cells (IC50= 19 μM). ELQ-598 can be used for research into babesiosis[1].
| Trivial name | ELQ-598 |
| Catalog Number | HY-163483 |
| Research Area | Others |
| CAS# | 3023709-99-8 |
| Purity | ≥98.0% |
| SMILES | ClC1=CC2=C(N=C(C)C(C3=CC=C(C4=CC=C(OC(F)(F)F)C=C4)C=C3)=C2OCOC(OCC)=O)C=C1OC |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/elq-598.html |