Nav1.8-IN-5 | MedChemExpress (MCE)
Nav1.8-IN-5 (Example 1) is a voltage-gated sodium channel Nav1.8 inhibitor. Nav1.8-IN-5 can be used for Nav1.8-mediated diseases, such as pain and pain-related disorders, as well as cardiovascular diseases (such as atrial fibrillation) research[1].
| Trivial name | Nav1.8-IN-5 |
| Catalog Number | HY-162246 |
| Research Area | Neurological Disease; Cardiovascular Disease |
| CAS# | 3023247-79-9 |
| Purity | ≥98.0% |
| SMILES | O=C(C=C1)NC2=C1N3CN(C4=CC=C(F)C=C4C/C=C/2)C5=CC=C(C(F)(F)F)C=C5C3=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/nav1-8-in-5.html |