Deoxycholic acid sodium salt
Deoxycholic acid sodium salt (Sodium Deoxycholate, Sodium Desoxycholate, Cholanoic Acid, ATX-101, Kythera, Belkyra, DCA) is specifically responsible for activating the TGR5 receptor (GPCR19) that stimulates brown adipose tissue (BAT) thermogenic activity.
| Trivial name | Sodium Deoxycholate, Sodium Desoxycholate, Cholanoic Acid, ATX-101, Kythera, Belkyra, DCA |
| Catalog Number | S3069 |
| Molecular Formula | C24H39NaO4 |
| CAS# | 302-95-4 |
| SMILES | [Na+].CC(CCC([O-])=O)C1CCC2C3CCC4CC(O)CCC4(C)C3CC(O)C12C |
| Size | 25mg |
| Supplier Page | http://www.selleckchem.com/products/deoxycholic-acid-sodium-salt.html |
| Additional Information | https://file.selleck.cn/downloads/struct/s3069-sodium-desoxycholate-chemical-structure.gif |