Tretinoin
API Standard
| Trivial name | NULL |
| Catalog Number | CS-O-30797 |
| Alternative Name(s) | Retinoic Acid;Retinoc cid;metabolite of vitamin A;metabolite of retinol;(2E,4E,6E,8E)-3,7-dimethyl-9-(2,6,6-trimethycclohexen-1-yl)nona-2,4,6,8-tetraenoc cid;Isotretinoin EP Impurity A. |
| Research Area | An important regulator of GENE EXPRESSION during growth and development, and in NEOPLASMS. Tretinoin, also known as retinoic acid and derived from maternal VITAMIN A, is essential for normal GROWTH; and EMBRYONIC DEVELOPMENT. An excess of tretinoin can be |
| Molecular Formula | C20H28O2 |
| CAS# | 302-79-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | CC(/C=C/C(C(C)(CCC1)C)=C1C)=CC=CC(C)=CC(O)=O |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO30797.html |
| Additional Information | NULL |