SB 431542 10mM * 1mL in DMSO
SB 431542 is a potent and specific inhibitor of transforming growth factor-?? superfamily type I activin receptor-like kinase (ALK) receptors ALK4, ALK5, and ALK7 .
Trivial name | SB 431542 10mM * 1mL in DMSO |
Catalog Number | A10826-10mM-D |
Alternative Name(s) | 4-[4-(1,3-benzodioxol-5-yl)-5-(2-pyridinyl)-1H-imidazol-2-yl]benzamide |
Molecular Formula | C22H16N4O3 |
CAS# | 301836-41-9 |
SMILES | C1OC2=C(O1)C=C(C=C2)C3=C(NC(=N3)C4=CC=C(C=C4)C(=O)N)C5=CC=CC=N5 |
Size | 10mM * 1mL in DMSO |
Supplier Page | http://www.adooq.com/sb-431542.html |