BTK-IN-34 | MedChemExpress (MCE)
BTK-IN-34 (compound 9h) is a selective BTK inhibitor. BTK-IN-34 shows antiproliferative activity in RAMOS cells through selective inhibition of pBTK (Tyr223) without affecting Lyn and Syk, upstream proteins in the BCR signaling pathway[1].
| Trivial name | BTK-IN-34 |
| Catalog Number | HY-162257 |
| Research Area | Cancer |
| CAS# | 3016419-52-3 |
| Purity | ≥98.0% |
| SMILES | O=C1NC2=C(C=C(S(=O)(N3CCN(C(CCCC)=O)CC3)=O)C=C2)/C1=C4CCCC\4 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/btk-in-34.html |