CIL56
CIL56 is a small molecule that induces cellular ferroptosis through the production of iron-dependent reactive oxygen species (ROS). It also induces accumulation of long-chain saturated, monounsaturated, and polyunsaturated fatty acids in HT-1080 cells in vitro.HT-1080 cells lacking acetyl-CoA carboxylase 1 (ACC1), the rate-limiting enzyme in fatty acid synthesis, exhibit 5-fold resistance to CIL56 treatment, indicating ACC1 activity sensitizes cells to CIL56-induced cell death.
| Catalog Number | T4309 |
| Alternative Name(s) | CA3 |
| Research Area | Immunology/Inflammation|||Apoptosis |
| Molecular Formula | C23H27N3O5S2 |
| CAS# | 300802-28-2 |
| Purity | 99.91% |
| SMILES | O\N=C1/c2cc(ccc2-c2ccc(cc12)S(=O)(=O)N1CCCCC1)S(=O)(=O)N1CCCCC1 |
| Size | 10 mg |
| Supplier Page | https://www.targetmol.com/compound/CIL56 |
| Additional Information | https://www.targetmol.com/datasheet/T4309 |
