FABP4 Inhibitor 10mg
FABP4 Inhibitor is a cell-permeable biphenylazolo-oxyacetate that acts as a potent and selective inhibitor of adipocyte Fatty-Acid-Binding Protein (aFABP/aP2) by targeting its fatty acid-binding pocket (Ki = < 2 nM in a competitive binding assay using 1,8-ANS), while exhibiting much lower affinity for muscle and epidermal FABP's (Ki = 250 nM and 350 nM, respectively).
| Trivial name | FABP4 Inhibitor 10mg |
| Catalog Number | A13404-10 |
| Alternative Name(s) | 2-[[2'-(5-Ethyl-3,4-diphenyl-1H-pyrazol-1-yl)[1,1'-biphenyl]-3-yl]oxy]acetic acid |
| Molecular Formula | C31H26N2O3 |
| CAS# | 300657-03-8 |
| SMILES | CCC1=C(C(=NN1C2=CC=CC=C2C3=CC(=CC=C3)OCC(=O)O)C4=CC=CC=C4)C5=CC=CC=C5 |
| Size | 10mg |
| Supplier Page | http://www.adooq.com/fabp4-inhibitor.html |
