V757053
Vinylbenzyl Chloride, Mixture of 2, 3- and 4-isomers (Stabilized with TBC)
| Trivial name | Vinylbenzyl Chloride, Mixture of 2, 3- and 4-isomers (Stabilized with TBC) |
| Catalog Number | TRC-V757053-5G |
| Alternative Name(s) | (Chloromethyl)ethenylbenzene; (Chloromethyl)styrene; CMS-AM; CMS-P; ar-(Chloromethyl)styrene; ar-Vinylbenzyl chloride |
| Molecular Formula | C₉H₉Cl |
| CAS# | 30030-25-2 |
| Inchi | InChI=1S/2C9H9Cl/c1-2-8-3-5-9(7-10)6-4-8;1-2-8-4-3-5-9(6-8)7-10/h2*2-6H,1,7H2 |
| SMILES | ClCC1=CC=CC(C=C)=C1.C=CC2=CC=C(CCl)C=C2 |
| Beilstein Registry Number | NA |
| Size | 5g |
| Supplier Page | https://www.lgcstandards.com/CA/en/p/TRC-V757053-5G |