NST-628 | MedChemExpress (MCE)
NST-628 is a brain-permeable MAPK pathway molecule glue that inhibits RAF phosphorylation and MEK activation. NST-628 also binds RAF and prevents the formation of BRAF-CRAF and BRAF-ARAF heterodimers, effectively inhibiting the RAS-MAPK pathway. NST-628 inhibits RAS- and RAF-driven cancers and demonstrated potent inhibition in mutant KRAS, NRAS, BRAF class II/III, and NF1-mutant tumors[1].
| Trivial name | NST-628 | 
| Catalog Number | HY-158115 | 
| Research Area | Cancer | 
| CAS# | 3002056-30-3 | 
| Purity | ≥98.0% | 
| SMILES | FC1=C(OC2=CC=C(C(C)=C(CC3=C(F)C(NS(NC)(=O)=O)=NC=C3)C(O4)=O)C4=C2)N=CC=C1 | 
| Size | 100 mg | 
| Supplier Page | https://www.medchemexpress.com/nst-628.html | 
 
                    