NST-628 | MedChemExpress (MCE)
NST-628 is a brain-permeable MAPK pathway molecule glue that inhibits RAF phosphorylation and MEK activation. NST-628 also binds RAF and prevents the formation of BRAF-CRAF and BRAF-ARAF heterodimers, effectively inhibiting the RAS-MAPK pathway. NST-628 inhibits RAS- and RAF-driven cancers and demonstrated potent inhibition in mutant KRAS, NRAS, BRAF class II/III, and NF1-mutant tumors[1].
Trivial name | NST-628 |
Catalog Number | HY-158115 |
Research Area | Cancer |
CAS# | 3002056-30-3 |
Purity | ≥98.0% |
SMILES | FC1=C(OC2=CC=C(C(C)=C(CC3=C(F)C(NS(NC)(=O)=O)=NC=C3)C(O4)=O)C4=C2)N=CC=C1 |
Size | 10 mg |
Supplier Page | https://www.medchemexpress.com/nst-628.html |