Vidarabine Monophosphate
An adenosine monophosphate analog in which ribose is replaced by an arabinose moiety. It is the monophosphate ester of VIDARABINE with antiviral and possibly antineoplastic properties.
| Catalog Number | API29984336 |
| Alternative Name(s) | VIDARABINE PHOSPHATE Ara-AMP Vidarabine phosphate [USAN] |
| Research Area | Antivirus APIs |
| Molecular Formula | C10H14N5O7P |
| CAS# | 29984-33-6 |
| SMILES | C1=NC(=C2C(=N1)N(C=N2)C3C(C(C(O3)COP(=O)(O)O)O)O)N |
| Size | inquiry |
| Supplier Page | https://www.protheragen-ing.com/vidarabine-monophosphate-item-12546.html |