NKY 80 50mg
NKY 80 is an inhibitor of adenylyl cyclase (AC). Exhibits greater affinity for AC5 over AC3 and AC2 (IC50 values are 8.3 ??M, 132 ??M and 1.7 mM respectively).
| Trivial name | NKY 80 50mg |
| Catalog Number | A13586-50 |
| Alternative Name(s) | 2-Amino-7-(2-furanyl)-7,8-dihydro-5(6H)-quinazolinone |
| Molecular Formula | C₁₂H₁₁N₃O₂ |
| CAS# | 299442-43-6 |
| SMILES | C1C(CC(=O)C2=CN=C(N=C21)N)C3=CC=CO3 |
| Size | 50mg |
| Supplier Page | http://www.adooq.com/nky-80.html |