Phenazine Methosulfate
Phenazine Methosulfate can be used with ascorbic acid to determine nitric oxide reductase activity.
| Trivial name | 5-Methylphenazinium methyl sulfate; N-Methylphenazonium methyl sulfate; PMS |
| Catalog Number | CSN23837 |
| Alternative Name(s) | 5-Methylphenazinium methyl sulfate; N-Methylphenazonium methyl sulfate; PMS |
| Research Area | / |
| Molecular Formula | C14H14N2O4S |
| CAS# | 299-11-6 |
| Purity | ≥97% |
| SMILES | C[N+]1=C2C=CC=CC2=NC3=C1C=CC=C3.O=S(OC)([O-])=O |
| Size | 50mg |
| Supplier Page | https://www.csnpharm.com/products/phenazine-methosulfate.html |