Phenazine Methosulfate
Phenazine Methosulfate can be used with ascorbic acid to determine nitric oxide reductase activity.
Trivial name | 5-Methylphenazinium methyl sulfate; N-Methylphenazonium methyl sulfate; PMS |
Catalog Number | CSN23837 |
Alternative Name(s) | 5-Methylphenazinium methyl sulfate; N-Methylphenazonium methyl sulfate; PMS |
Research Area | / |
Molecular Formula | C14H14N2O4S |
CAS# | 299-11-6 |
Purity | ≥97% |
SMILES | C[N+]1=C2C=CC=CC2=NC3=C1C=CC=C3.O=S(OC)([O-])=O |
Size | 25mg |
Supplier Page | https://www.csnpharm.com/products/phenazine-methosulfate.html |