MC-GGFG-AM-(10NH2-11F-Camptothecin) | MedChemExpress (MCE)
MC-GGFG-AM-(10NH2-11F-Camptothecin) is an antibody drug conjugates (ADC). MC-GGFG-AM-(10NH2-11F-Camptothecin) binds to the anti-TROp-2 antibody sacituzumab via a hydrolysable pH-sensitive linker and has anti-tumor activity. MC-GGFG-AM-(10NH2-11F-Camptothecin) can be used for cancer research[1].
| Trivial name | MC-GGFG-AM-(10NH2-11F-Camptothecin) |
| Catalog Number | HY-156514 |
| Research Area | Cancer |
| CAS# | 2987938-97-4 |
| Purity | ≥98.00% |
| SMILES | O=C1N2C(C(C(C2)=CC3=C4)=NC3=CC(F)=C4NC(CNC([C@@H](NC(CNC(CNC(CCCCCN5C(C=CC5=O)=O)=O)=O)=O)CC6=CC=CC=C6)=O)=O)=CC7=C1COC([C@]7(O)CC)=O |
| PubChem Chemical Structure ID | 168510616 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/mc-ggfg-am-10nh2-11f-camptothecin.html |