Pirenzepine 2HCl
Pirenzepine 2HCl is a is an anticholinergic agent and induces the dimerization of muscarinic M1 receptors, used to treat myopia, gastric and duodenal ulcers.
| Trivial name | Pirenzepine HCl; LS519 |
| Catalog Number | CSN11734 |
| Alternative Name(s) | Pirenzepine HCl; LS519 |
| Research Area | Neurological Disease |
| Molecular Formula | C19H23Cl2N5O2 |
| CAS# | 29868-97-1 |
| Purity | ≥99% |
| SMILES | O=C1C2=CC=CC=C2N(C(CN3CCN(C)CC3)=O)C4=NC=CC=C4N1.[H]Cl.[H]Cl |
| Size | 25mg |
| Supplier Page | https://www.csnpharm.com/products/pirenzepine-2hcl.html |