Astilbin
Astilbin is a flavonoid compound that can enhance NRF2 activition with anti-inflammatory properties. It could be extracted from chinese astilbe. Astilbin has been found to have significant immunosuppressive effects in recent years.
| Trivial name | Taxifolin 3-O-Rhamnoside |
| Catalog Number | CSN15955 |
| Alternative Name(s) | Taxifolin 3-O-Rhamnoside |
| Research Area | Immunology/Inflammation |
| Molecular Formula | C21H22O11 |
| CAS# | 29838-67-3 |
| Purity | ≥99% |
| SMILES | O=C1[C@H](O[C@H]2[C@@H]([C@@H]([C@H]([C@H](C)O2)O)O)O)[C@@H](C3=CC=C(O)C(O)=C3)OC4=CC(O)=CC(O)=C14 |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/astilbin.html |