Dihydronovobiocin | MedChemExpress (MCE)
Dihydronovobiocin is a bacterial inhibitor and ATPase inhibitor that can bind to GyrB. Dihydronovobiocin can be used to study the interaction between coumarin antibiotics (such as Novobiocin, Chlorobiocin, and Coumermycin) and DNA gyrase. Dihydronovobiocin also has the potential to study bacterial infections[1][2].

Trivial name | Dihydronovobiocin |
Catalog Number | HY-141442 |
Research Area | Infection |
CAS# | 29826-16-2 |
Purity | ≥98.0% |
SMILES | CC1=C2C(C(O)=C(C(O2)=O)NC(C3=CC(CCC(C)C)=C(C=C3)O)=O)=CC=C1O[C@H]4[C@@H]([C@@H]([C@H](C(C)(O4)C)OC)OC(N)=O)O |
Size | 1 mg |
Supplier Page | https://www.medchemexpress.com/dihydronovobiocin.html |