Tetrazolium Red
Tetrazolium Red is a redox indicator used to visualize dehydrogenase enzyme activity and initially the tetrazolium solution is colorless but changes to red when it comes into contact with hydrogen.
| Trivial name | TTC; TPTZ; 2,3,5-Triphenyltetrazolium Chloride |
| Catalog Number | CSN18698 |
| Alternative Name(s) | TTC; TPTZ; 2,3,5-Triphenyltetrazolium Chloride |
| Research Area | / |
| Molecular Formula | C19H15ClN4 |
| CAS# | 298-96-4 |
| Purity | ≥99% |
| SMILES | [N+]1(C2=CC=CC=C2)=NC(C3=CC=CC=C3)=NN1C4=CC=CC=C4.[Cl-] |
| Size | 1g |
| Supplier Page | https://www.csnpharm.com/products/tetrazolium-red.html |