Methoxsalen
API Standard
| Catalog Number | CS-O-01892 |
| Alternative Name(s) | 9-methoxy-7H-furo[3,2-gchromen-7-one |
| Research Area | Methoxsalen is a naturally occurring substance isolated from the seeds of the plant Ammi majus with photoactivating properties. As a member of the family of compounds known as psoralens or furocoumarins, methoxsalen's exact mechanism of action is unknown; |
| Molecular Formula | C12H8O4 |
| CAS# | 298-81-7 |
| Purity | >98% |
| SMILES | COC1=C(OC=C2)C2=CC(C=C3)=C1OC3=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO01892.html |