Carbamazepine (1093001)
USP Standards
| Trivial name | NULL |
| Catalog Number | CS-EB-02315 |
| Alternative Name(s) | benzo[b][1]benzazepine-11-carboxamide; 5H-Dibenz[b,f]azepine-5-carboxamide; 5-Carbamoyl-5H-dibenz[b,f]azepine; Amizepin; Biston; CBZ; Calepsin; Carbamazepen; Carbamazepin; G 32883; Geigy 32883; Karbamazepin; Karbelex; Karberol; NSC 169864; Tegretol; |
| Research Area | Used in treatment of pain associated with trigeminal neuralgia. Anticonvulsant. Neuroprotective & Neuroresearch Product. |
| Molecular Formula | C15H12N2O |
| CAS# | 298-46-4 |
| Purity | >98% |
| Inchi | NULL |
| Inchi Key | NULL |
| SMILES | C1=CC=C2C(=C1)C=CC3=CC=CC=C3N2C(=O)N |
| Beilstein Registry Number | NULL |
| Condensed Formula | NULL |
| EC Number | NULL |
| PubChem Chemical Structure ID | NULL |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSEB02315.html |
| Additional Information | NULL |