Teniposide
Teniposide, a semisynthetic derivative of podophyllotoxin with antitumor activity, inhibits DNA synthesis by forming a complex with topoisomerase II and DNA.
| Catalog Number | T1523 |
| Alternative Name(s) | VM26 , NSC 122819 |
| Research Area | DNA Damage/DNA Repair |
| Molecular Formula | C32H32O13S |
| CAS# | 29767-20-2 |
| Purity | 97.84% |
| SMILES | O1COc2c1cc1[C@H]([C@@H]3[C@@H]([C@@H](c1c2)c1cc(c(c(c1)OC)O)OC)C(=O)OC3)O[C@H]1[C@@H]([C@H]([C@@H]2O[C@@H](OC[C@H]2O1)c1cccs1)O)O |
| Size | 50 mg |
| Supplier Page | https://www.targetmol.com/compound/Teniposide |
| Additional Information | https://www.targetmol.com/datasheet/T1523 |