Tyrosinase-IN-27 | MedChemExpress (MCE)
Tyrosinase-IN-27 (compound 6f) is a tyrosinase (TYR) inhibitor (IC50: 0.88 μM) that statically quenches TYR. Tyrosinase-IN-27 increases the hydrophobicity of the enzyme microenvironment by binding to TYR, reducing the content of α-helices in the enzyme and changing its secondary structure. Tyrosinase-IN-27 can be used in the food industry to effectively inhibit the browning of lotus root slices.[18][1].
| Trivial name | Tyrosinase-IN-27 |
| Catalog Number | HY-158235 |
| Research Area | Others |
| CAS# | 2966803-96-1 |
| Purity | ≥98.0% |
| SMILES | CCCC1=CC(OC2=C1C=CC(OCC3=CC(C(O)=CO3)=O)=C2)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/tyrosinase-in-27.html |