Val-Cit-PAB-DEA-Dxd | MedChemExpress (MCE)
Val-Cit-PAB-DEA-Dxd (compound 81) is a Drug-Linker Conjugates for ADC, which is composed of a linker and a toxic molecule Dxd (DNA topoisomerase I inhibitor). Val-Cit-PAB-DEA-Dxd can be used for ADC synthesis[1].
| Trivial name | Val-Cit-PAB-DEA-Dxd |
| Catalog Number | HY-158137 |
| Research Area | Cancer |
| CAS# | 2964543-53-9 |
| Purity | ≥98.0% |
| SMILES | CC(C)[C@H](N)C(N[C@@H](CCCNC(N)=O)C(NC(C=C1)=CC=C1COC(N(C)CCN(C)C(OCC(N[C@@H]2C3=C4C(C(N5C4)=CC([C@](O)(C(OC6)=O)CC)=C6C5=O)=NC7=CC(F)=C(C)C(CC2)=C73)=O)=O)=O)=O)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/val-cit-pab-dea-dxd.html |