Almitrine Mesylate
Almitrine mesylate is an agonist of peripheral chemoreceptor and inhibits selectively the Ca2+-dependent K+ channel. It can improve chronic obstructive pulmonary disease and nocturnal oxygen desaturation.
| Trivial name | / |
| Catalog Number | CSN21132 |
| Alternative Name(s) | / |
| Research Area | Cardiovascular Disease|Neurological Disease |
| Molecular Formula | C28H37F2N7O6S2 |
| CAS# | 29608-49-9 |
| Purity | ≥98% |
| SMILES | CS(=O)(O)=O.FC1=CC=C(C=C1)C(C2=CC=C(F)C=C2)N3CCN(C4=NC(NCC=C)=NC(NCC=C)=N4)CC3.CS(=O)(O)=O |
| Size | 10mg |
| Supplier Page | https://www.csnpharm.com/products/almitrine-mesylate.html |
