Almitrine Bismesylate
API Standard
| Catalog Number | CS-O-05676 |
| Alternative Name(s) | 6-{4-[bis(4-fluorophenyl)methyl]piperazin-1-yl}- N2,N4-bis(prop-2-en-1-yl)-1,3,5-triazine-2,4- diamine; bis(methanesulfonc cid) |
| Research Area | Almitrine bismesylate is a respiratory stimulant that enhances respiration by acting as an agonist of peripheral chemoreceptors located on the carotid bodies. The drug increases arterial oxygen tension while decreasing arterial carbon dioxide tension in p |
| Molecular Formula | C27H33F2N7O3S |
| CAS# | 29608-49-9 |
| Purity | >98% |
| SMILES | C[S](=O)(O)=O.FC1=CC=C(C=C1)C(C2=CC=C(F)C=C2)N3CCN(C4=NC(NCC=C)=NC(NCC=C)=N4)CC3.C[S](=O)(O)=O |
| Size | 500 g |
| Supplier Page | https://www.clearsynth.com/en/CSO05676.html |