AChE-IN-59 | MedChemExpress (MCE)
AChE-IN-59 (compounds 3b) is an AChE inhibitor, with an IC50 value of 0.05 μM. AChE-IN-59 can inhibit the aggregation of Aβ1-42, protect nerve cells and penetrate the blood-brain barrier well. AChE-IN-59 can be used for the research of Alzheimer’s disease (AD)[1].
| Trivial name | AChE-IN-59 |
| Catalog Number | HY-157978 |
| Research Area | Neurological Disease |
| CAS# | 2957916-86-6 |
| Purity | ≥98.0% |
| SMILES | COC1=CC=C2C=C(C(OC2=C1)=O)NC(C3CCN(CC3)CC4=CC(OC)=CC(OC)=C4)=O |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/ache-in-59.html |