α-Glucosidase-IN-28 | MedChemExpress (MCE)
α-Glucosidase-IN-28 (Compound 18) is a α-Glucosidase inhibitor (IC50: 0.62 μM, Ki: 3.93 μM). α-Glucosidase-IN-28 binds to α-glucosidase at the original binding site (OBS), and forms multiple hydrophobic interactions with nearby amino acids. α-Glucosidase-IN-28 can be used for research of diabetes and related diseases[1].
| Trivial name | α-Glucosidase-IN-28 |
| Catalog Number | HY-149341 |
| Research Area | Metabolic Disease |
| CAS# | 2949513-10-2 |
| Purity | ≥98.00% |
| SMILES | OC(C1=CC=CC=C1O2)=C(C(C3=CC(Br)=C(OCCCC)C(Br)=C3)C4=C(O)C(C=CC=C5)=C5OC4=O)C2=O |
| PubChem Chemical Structure ID | 168476114 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/α-glucosidase-in-28.html |