LUF7690 | MedChemExpress (MCE)
LUF7690 (Compound 9) is a clickable and covalent affinity-based probe (AfBP) that targets the human A3AR (hA3AR). LUF7690 can be used in the detection and characterization of the hA3AR in different types of granulocytes, among other cell types[1].
| Trivial name | LUF7690 |
| Catalog Number | HY-155772 |
| Research Area | Inflammation/Immunology |
| CAS# | 2941609-83-0 |
| Purity | ≥98.00% |
| SMILES | O=S(C1=CC=C(C(NCCCN(C(N2CCC)=O)C3=C(N4C(C=C(OCC#C)C=C4)=N3)C2=O)=O)C=C1)(F)=O |
| PubChem Chemical Structure ID | 168510594 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/luf7690.html |