BCL-xL/BCL-2 ligand 1 | MedChemExpress (MCE)
BCL-xL/BCL-2 ligand 1 (compound 72-1) is a BCL-xL and BCL-2 protein ligand. BCL-xL/BCL-2 ligand 1 can be connected to the E3 ligase by a linker to form PROTACs (HY-161410)[1][2].
| Trivial name | BCL-xL/BCL-2 ligand 1 |
| Catalog Number | HY-161415 |
| Research Area | Cancer |
| CAS# | 2941091-91-2 |
| Purity | ≥98.0% |
| SMILES | O=C[C@@](C)(C1)CCC(C2=CC=C(C=C2)Cl)=C1CN3CCN(C4=CC=C(C=C4)C(NS(=O)(C5=CC(S(C(F)(F)F)(=O)=O)=C(C=C5)N[C@@H](CSC6=CC=CC=C6)CCN7[C@]8([H])C[C@](OC8)([H])C7)=O)=O)CC3 |
| Size | 1 mg |
| Supplier Page | https://www.medchemexpress.com/bcl-xl-bcl-2-ligand-1.html |