Secoisolariciresinol
Secoisolariciresinol, a natural product isolated and purified from the Heartwood of Podocarpus spicata, exerts a suppressive effect on the gain of body weight of mice fed a high-fat diet by inducing gene expression of adiponectin, resulting in the altered expression of various genes related to the synthesis and β-oxidation of fatty acids.
| Trivial name | (-)-Secoisolariciresinol |
| Catalog Number | CSN11910 |
| Alternative Name(s) | (-)-Secoisolariciresinol |
| Research Area | Metabolic Disease |
| Molecular Formula | C20H26O6 |
| CAS# | 29388-59-8 |
| Purity | ≥98% |
| SMILES | COC1=C(O)C=CC(C[C@@H](CO)[C@H](CO)CC2=CC(OC)=C(O)C=C2)=C1 |
| Size | 5mg |
| Supplier Page | https://www.csnpharm.com/products/secoisolariciresinol.html |